C29H35ClF2N2O2 — CID 20796650
[4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(4-fluorophenyl)butyl]piperidin-4-yl]methanol (PubChem CID 20796650) has the molecular formula C29H35ClF2N2O2 and a molecular weight of 517.06 g/mol. Its IUPAC name is [4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(4-fluorophenyl)butyl]piperidin-4-yl]methanol.
| Compound Name | [4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(4-fluorophenyl)butyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 20796650 |
| Molecular Formula | C29H35ClF2N2O2 |
| Molecular Weight | 517.06 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(4-fluorophenyl)butyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c([C@H](F)CCC3(CO)CCN(CCCCc4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C29H35ClF2N2O2/c1-36-23-9-10-27-24(18-23)28(25(30)19-33-27)26(32)11-12-29(20-35)13-16-34(17-14-29)15-3-2-4-21-5-7-22(31)8-6-21/h5-10,18-19,26,35H,2-4,11-17,20H2,1H3/t26-/m1/s1 |
| InChIKey | UMAWFFWBVZPFTB-AREMUKBSSA-N |
| XLogP | 6.92 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.06 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|