C26H33ClFN3O2S — CID 22398746
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol (PubChem CID 22398746) has the molecular formula C26H33ClFN3O2S and a molecular weight of 506.09 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22398746 |
| Molecular Formula | C26H33ClFN3O2S |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(CO)CCN(CCCCc4nccs4)CC3)c2c1 |
| InChI | InChI=1S/C26H33ClFN3O2S/c1-33-19-5-6-23-20(16-19)25(21(27)17-30-23)22(28)7-8-26(18-32)9-13-31(14-10-26)12-3-2-4-24-29-11-15-34-24/h5-6,11,15-17,22,32H,2-4,7-10,12-14,18H2,1H3 |
| InChIKey | OPIIHNSXVSOGRA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|