C26H34ClN3O2S — CID 22470390
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol (PubChem CID 22470390) has the molecular formula C26H34ClN3O2S and a molecular weight of 488.10 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22470390 |
| Molecular Formula | C26H34ClN3O2S |
| Molecular Weight | 488.10 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CO)CCN(CCCCc4nccs4)CC3)c2c1 |
| InChI | InChI=1S/C26H34ClN3O2S/c1-32-20-7-8-24-22(17-20)21(23(27)18-29-24)5-4-9-26(19-31)10-14-30(15-11-26)13-3-2-6-25-28-12-16-33-25/h7-8,12,16-18,31H,2-6,9-11,13-15,19H2,1H3 |
| InChIKey | PELPKECXVHSNDA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.10 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|