C29H35ClN2O3S — CID 22468946
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-phenylsulfanylpropyl)piperidin-4-yl]acetic acid (PubChem CID 22468946) has the molecular formula C29H35ClN2O3S and a molecular weight of 527.13 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-phenylsulfanylpropyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-phenylsulfanylpropyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22468946 |
| Molecular Formula | C29H35ClN2O3S |
| Molecular Weight | 527.13 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-phenylsulfanylpropyl)piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CC(=O)O)CCN(CCCSc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C29H35ClN2O3S/c1-35-22-10-11-27-25(19-22)24(26(30)21-31-27)9-5-12-29(20-28(33)34)13-16-32(17-14-29)15-6-18-36-23-7-3-2-4-8-23/h2-4,7-8,10-11,19,21H,5-6,9,12-18,20H2,1H3,(H,33,34) |
| InChIKey | HOMOUYKMKXPVDS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.13 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|