C28H30ClN3O3 — CID 22470328
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidin-4-yl]acetic acid (PubChem CID 22470328) has the molecular formula C28H30ClN3O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22470328 |
| Molecular Formula | C28H30ClN3O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CC(=O)O)CCN(CC#Cc4ccncc4)CC3)c2c1 |
| InChI | InChI=1S/C28H30ClN3O3/c1-35-22-6-7-26-24(18-22)23(25(29)20-31-26)5-2-10-28(19-27(33)34)11-16-32(17-12-28)15-3-4-21-8-13-30-14-9-21/h6-9,13-14,18,20H,2,5,10-12,15-17,19H2,1H3,(H,33,34) |
| InChIKey | GUPZJTGSXVEAOQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|