C27H35ClN4O2 — CID 22468478
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]methanol (PubChem CID 22468478) has the molecular formula C27H35ClN4O2 and a molecular weight of 483.06 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22468478 |
| Molecular Formula | C27H35ClN4O2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CO)CCN(CCCCc4cnccn4)CC3)c2c1 |
| InChI | InChI=1S/C27H35ClN4O2/c1-34-22-7-8-26-24(17-22)23(25(28)19-31-26)6-4-9-27(20-33)10-15-32(16-11-27)14-3-2-5-21-18-29-12-13-30-21/h7-8,12-13,17-19,33H,2-6,9-11,14-16,20H2,1H3 |
| InChIKey | GXVCVBKPBACDHN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|