C28H35ClN4O4 — CID 22470880
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]acetic acid (PubChem CID 22470880) has the molecular formula C28H35ClN4O4 and a molecular weight of 527.07 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22470880 |
| Molecular Formula | C28H35ClN4O4 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyrazin-2-ylbutyl)piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(CC(=O)O)CCN(CCCCc4cnccn4)CC3)c2c1 |
| InChI | InChI=1S/C28H35ClN4O4/c1-37-21-5-6-24-22(16-21)27(23(29)19-32-24)25(34)7-8-28(17-26(35)36)9-14-33(15-10-28)13-3-2-4-20-18-30-11-12-31-20/h5-6,11-12,16,18-19,25,34H,2-4,7-10,13-15,17H2,1H3,(H,35,36) |
| InChIKey | ZTVCRQXMRSGJAP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|