C28H36ClN3O3 — CID 20797708
(1R)-1-(3-chloro-6-methoxyquinolin-4-yl)-3-[4-(hydroxymethyl)-1-(4-pyridin-3-ylbutyl)piperidin-4-yl]propan-1-ol (PubChem CID 20797708) has the molecular formula C28H36ClN3O3 and a molecular weight of 498.07 g/mol. Its IUPAC name is (1R)-1-(3-chloro-6-methoxyquinolin-4-yl)-3-[4-(hydroxymethyl)-1-(4-pyridin-3-ylbutyl)piperidin-4-yl]propan-1-ol.
| Compound Name | (1R)-1-(3-chloro-6-methoxyquinolin-4-yl)-3-[4-(hydroxymethyl)-1-(4-pyridin-3-ylbutyl)piperidin-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 20797708 |
| Molecular Formula | C28H36ClN3O3 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (1R)-1-(3-chloro-6-methoxyquinolin-4-yl)-3-[4-(hydroxymethyl)-1-(4-pyridin-3-ylbutyl)piperidin-4-yl]propan-1-ol |
| SMILES | COc1ccc2ncc(Cl)c([C@H](O)CCC3(CO)CCN(CCCCc4cccnc4)CC3)c2c1 |
| InChI | InChI=1S/C28H36ClN3O3/c1-35-22-7-8-25-23(17-22)27(24(29)19-31-25)26(34)9-10-28(20-33)11-15-32(16-12-28)14-3-2-5-21-6-4-13-30-18-21/h4,6-8,13,17-19,26,33-34H,2-3,5,9-12,14-16,20H2,1H3/t26-/m1/s1 |
| InChIKey | UTYUNQIQZDAQNC-AREMUKBSSA-N |
| XLogP | 5.20 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|