C27H32ClN3O4S — CID 22469909
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidine-4-carboxylic acid (PubChem CID 22469909) has the molecular formula C27H32ClN3O4S and a molecular weight of 530.09 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidine-4-carboxylic acid.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22469909 |
| Molecular Formula | C27H32ClN3O4S |
| Molecular Weight | 530.09 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(C(=O)O)CCN(CCCSc4cccnc4)CC3)c2c1 |
| InChI | InChI=1S/C27H32ClN3O4S/c1-35-19-5-6-23-21(16-19)25(22(28)18-30-23)24(32)7-8-27(26(33)34)9-13-31(14-10-27)12-3-15-36-20-4-2-11-29-17-20/h2,4-6,11,16-18,24,32H,3,7-10,12-15H2,1H3,(H,33,34) |
| InChIKey | AYBNAPPZQMWMHL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.09 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|