C29H34ClFN2O4 — CID 20797696
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[4-(4-fluorophenyl)butyl]piperidine-4-carboxylic acid (PubChem CID 20797696) has the molecular formula C29H34ClFN2O4 and a molecular weight of 529.05 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[4-(4-fluorophenyl)butyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[4-(4-fluorophenyl)butyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20797696 |
| Molecular Formula | C29H34ClFN2O4 |
| Molecular Weight | 529.05 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[4-(4-fluorophenyl)butyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(Cl)c([C@H](O)CCC3(C(=O)O)CCN(CCCCc4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C29H34ClFN2O4/c1-37-22-9-10-25-23(18-22)27(24(30)19-32-25)26(34)11-12-29(28(35)36)13-16-33(17-14-29)15-3-2-4-20-5-7-21(31)8-6-20/h5-10,18-19,26,34H,2-4,11-17H2,1H3,(H,35,36)/t26-/m1/s1 |
| InChIKey | YUDVDRVMIPDZJJ-AREMUKBSSA-N |
| XLogP | 6.04 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.05 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|