C29H36ClN3O4 — CID 18177653
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyridin-2-ylbutyl)piperidin-4-yl]acetic acid (PubChem CID 18177653) has the molecular formula C29H36ClN3O4 and a molecular weight of 526.08 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyridin-2-ylbutyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyridin-2-ylbutyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 18177653 |
| Molecular Formula | C29H36ClN3O4 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-pyridin-2-ylbutyl)piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(CC(=O)O)CCN(CCCCc4ccccn4)CC3)c2c1 |
| InChI | InChI=1S/C29H36ClN3O4/c1-37-22-8-9-25-23(18-22)28(24(30)20-32-25)26(34)10-11-29(19-27(35)36)12-16-33(17-13-29)15-5-3-7-21-6-2-4-14-31-21/h2,4,6,8-9,14,18,20,26,34H,3,5,7,10-13,15-17,19H2,1H3,(H,35,36) |
| InChIKey | MIYIXPSTTJATCX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|