C28H30ClFN2O2 — CID 22469252
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(4-fluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol (PubChem CID 22469252) has the molecular formula C28H30ClFN2O2 and a molecular weight of 481.01 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(4-fluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(4-fluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22469252 |
| Molecular Formula | C28H30ClFN2O2 |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(4-fluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CO)CCN(CC#Cc4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C28H30ClFN2O2/c1-34-23-10-11-27-25(18-23)24(26(29)19-31-27)5-2-12-28(20-33)13-16-32(17-14-28)15-3-4-21-6-8-22(30)9-7-21/h6-11,18-19,33H,2,5,12-17,20H2,1H3 |
| InChIKey | BEKOSEDPVFGJQN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|