C26H29FN2O2S — CID 22470321
[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-4-yl]methanol (PubChem CID 22470321) has the molecular formula C26H29FN2O2S and a molecular weight of 452.60 g/mol. Its IUPAC name is [4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22470321 |
| Molecular Formula | C26H29FN2O2S |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(F)c(CCCC3(CO)CCN(CC#Cc4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C26H29FN2O2S/c1-31-20-8-9-25-23(17-20)22(24(27)18-28-25)7-2-10-26(19-30)11-14-29(15-12-26)13-3-5-21-6-4-16-32-21/h4,6,8-9,16-18,30H,2,7,10-15,19H2,1H3 |
| InChIKey | FBKYCYUBYMDQPO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|