C29H30F4N2O2 — CID 22468413
[4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol (PubChem CID 22468413) has the molecular formula C29H30F4N2O2 and a molecular weight of 514.56 g/mol. Its IUPAC name is [4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22468413 |
| Molecular Formula | C29H30F4N2O2 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(CF)c(CCCC3(CO)CCN(CC#Cc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C29H30F4N2O2/c1-37-23-6-7-27-25(16-23)24(21(17-30)18-34-27)5-2-8-29(19-36)9-12-35(13-10-29)11-3-4-20-14-22(31)15-26(32)28(20)33/h6-7,14-16,18,36H,2,5,8-13,17,19H2,1H3 |
| InChIKey | WHGSMPVOQUAVOA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|