C29H29F3N2O4 — CID 22471292
4-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid (PubChem CID 22471292) has the molecular formula C29H29F3N2O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is 4-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22471292 |
| Molecular Formula | C29H29F3N2O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 4-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(CO)c(CCCC3(C(=O)O)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H29F3N2O4/c1-38-21-6-7-26-23(16-21)22(20(18-35)17-33-26)5-2-8-29(28(36)37)9-12-34(13-10-29)11-3-4-19-14-24(30)27(32)25(31)15-19/h6-7,14-17,35H,2,5,8-13,18H2,1H3,(H,36,37) |
| InChIKey | DNWAZCCLGGNKHH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|