C28H30ClF3N2O3 — CID 22469302
4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxylic acid (PubChem CID 22469302) has the molecular formula C28H30ClF3N2O3 and a molecular weight of 535.01 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22469302 |
| Molecular Formula | C28H30ClF3N2O3 |
| Molecular Weight | 535.01 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)O)CCN(CCCc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C28H30ClF3N2O3/c1-37-20-6-7-25-22(16-20)21(23(29)17-33-25)5-2-8-28(27(35)36)9-12-34(13-10-28)11-3-4-18-14-19(30)15-24(31)26(18)32/h6-7,14-17H,2-5,8-13H2,1H3,(H,35,36) |
| InChIKey | CXNVHKIPPBICQS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|