C28H28ClF3N2O2 — CID 22470096
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol (PubChem CID 22470096) has the molecular formula C28H28ClF3N2O2 and a molecular weight of 516.99 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22470096 |
| Molecular Formula | C28H28ClF3N2O2 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CO)CCN(CC#Cc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C28H28ClF3N2O2/c1-36-20-6-7-27-23(16-20)21(24(29)17-33-27)4-2-8-28(18-35)9-12-34(13-10-28)11-3-5-22-25(31)14-19(30)15-26(22)32/h6-7,14-17,35H,2,4,8-13,18H2,1H3 |
| InChIKey | ZXQLTHSCNQVRFD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|