C30H32F3N3O4 — CID 20797807
4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid (PubChem CID 20797807) has the molecular formula C30H32F3N3O4 and a molecular weight of 555.60 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20797807 |
| Molecular Formula | C30H32F3N3O4 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(N(C)C)c([C@H](O)CCC3(C(=O)O)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C30H32F3N3O4/c1-35(2)25-18-34-24-7-6-20(40-3)17-21(24)27(25)26(37)8-9-30(29(38)39)10-13-36(14-11-30)12-4-5-19-15-22(31)28(33)23(32)16-19/h6-7,15-18,26,37H,8-14H2,1-3H3,(H,38,39)/t26-/m1/s1 |
| InChIKey | WZKNQXCLAWBIQI-AREMUKBSSA-N |
| XLogP | 4.76 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|