C31H33F4N3O3 — CID 70019932
2-[4-[(3S)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid (PubChem CID 70019932) has the molecular formula C31H33F4N3O3 and a molecular weight of 571.62 g/mol. Its IUPAC name is 2-[4-[(3S)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[(3S)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70019932 |
| Molecular Formula | C31H33F4N3O3 |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 2-[4-[(3S)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(N(C)C)c([C@@H](F)CCC3(CC(=O)O)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C31H33F4N3O3/c1-37(2)27-19-36-26-7-6-21(41-3)17-22(26)29(27)23(32)8-9-31(18-28(39)40)10-13-38(14-11-31)12-4-5-20-15-24(33)30(35)25(34)16-20/h6-7,15-17,19,23H,8-14,18H2,1-3H3,(H,39,40)/t23-/m0/s1 |
| InChIKey | OSFGWSDIOTWSME-QHCPKHFHSA-N |
| XLogP | 6.13 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|