C29H27F5N2O3 — CID 22471207
2-[4-[3-fluoro-3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid (PubChem CID 22471207) has the molecular formula C29H27F5N2O3 and a molecular weight of 546.54 g/mol. Its IUPAC name is 2-[4-[3-fluoro-3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-fluoro-3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22471207 |
| Molecular Formula | C29H27F5N2O3 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 2-[4-[3-fluoro-3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(F)c(C(F)CCC3(CC(=O)O)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H27F5N2O3/c1-39-19-4-5-25-20(15-19)27(24(33)17-35-25)21(30)6-7-29(16-26(37)38)8-11-36(12-9-29)10-2-3-18-13-22(31)28(34)23(32)14-18/h4-5,13-15,17,21H,6-12,16H2,1H3,(H,37,38) |
| InChIKey | HGYCPQYYFMSKHW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|