C30H28ClF6N3O3 — CID 22471199
1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22471199) has the molecular formula C30H28ClF6N3O3 and a molecular weight of 628.01 g/mol. Its IUPAC name is 1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22471199 |
| Molecular Formula | C30H28ClF6N3O3 |
| Molecular Weight | 628.01 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)NO)CCN(CC#Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3)c2c1 |
| InChI | InChI=1S/C30H28ClF6N3O3/c1-43-22-6-7-26-24(17-22)23(25(31)18-38-26)5-2-8-28(27(41)39-42)9-12-40(13-10-28)11-3-4-19-14-20(29(32,33)34)16-21(15-19)30(35,36)37/h6-7,14-18,42H,2,5,8-13H2,1H3,(H,39,41) |
| InChIKey | TWXSBCXCIVSKTL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.01 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|