C25H30ClN5O3S — CID 22470784
4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(2-pyrazin-2-ylsulfanylethyl)piperidine-4-carboxamide (PubChem CID 22470784) has the molecular formula C25H30ClN5O3S and a molecular weight of 516.07 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(2-pyrazin-2-ylsulfanylethyl)piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(2-pyrazin-2-ylsulfanylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470784 |
| Molecular Formula | C25H30ClN5O3S |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(2-pyrazin-2-ylsulfanylethyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)NO)CCN(CCSc4cnccn4)CC3)c2c1 |
| InChI | InChI=1S/C25H30ClN5O3S/c1-34-18-4-5-22-20(15-18)19(21(26)16-29-22)3-2-6-25(24(32)30-33)7-11-31(12-8-25)13-14-35-23-17-27-9-10-28-23/h4-5,9-10,15-17,33H,2-3,6-8,11-14H2,1H3,(H,30,32) |
| InChIKey | VJVQPUMSJGZKKV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|