C26H30ClFN4O3S — CID 20796392
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(2-pyridin-4-ylsulfanylethyl)piperidine-4-carboxamide (PubChem CID 20796392) has the molecular formula C26H30ClFN4O3S and a molecular weight of 533.07 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(2-pyridin-4-ylsulfanylethyl)piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(2-pyridin-4-ylsulfanylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796392 |
| Molecular Formula | C26H30ClFN4O3S |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(2-pyridin-4-ylsulfanylethyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](F)CCC3(C(=O)NO)CCN(CCSc4ccncc4)CC3)c2c1 |
| InChI | InChI=1S/C26H30ClFN4O3S/c1-35-18-2-3-23-20(16-18)24(21(27)17-30-23)22(28)4-7-26(25(33)31-34)8-12-32(13-9-26)14-15-36-19-5-10-29-11-6-19/h2-3,5-6,10-11,16-17,22,34H,4,7-9,12-15H2,1H3,(H,31,33)/t22-/m1/s1 |
| InChIKey | GUBQDYSMQZPQMU-JOCHJYFZSA-N |
| XLogP | 5.46 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|