C25H30ClN3O4S2 — CID 22471668
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-(2-thiophen-3-ylsulfanylethyl)piperidine-4-carboxamide (PubChem CID 22471668) has the molecular formula C25H30ClN3O4S2 and a molecular weight of 536.12 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-(2-thiophen-3-ylsulfanylethyl)piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-(2-thiophen-3-ylsulfanylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22471668 |
| Molecular Formula | C25H30ClN3O4S2 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-(2-thiophen-3-ylsulfanylethyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(C(=O)NO)CCN(CCSc4ccsc4)CC3)c2c1 |
| InChI | InChI=1S/C25H30ClN3O4S2/c1-33-17-2-3-21-19(14-17)23(20(26)15-27-21)22(30)4-6-25(24(31)28-32)7-9-29(10-8-25)11-13-35-18-5-12-34-16-18/h2-3,5,12,14-16,22,30,32H,4,6-11,13H2,1H3,(H,28,31) |
| InChIKey | UUMFXQDJSAFXDJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|