C26H35ClFN3O3S — CID 20796376
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 20796376) has the molecular formula C26H35ClFN3O3S and a molecular weight of 524.10 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796376 |
| Molecular Formula | C26H35ClFN3O3S |
| Molecular Weight | 524.10 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](F)CCC3(C(=O)NO)CCN(CCSC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C26H35ClFN3O3S/c1-34-18-6-7-23-20(16-18)24(21(27)17-29-23)22(28)8-9-26(25(32)30-33)10-12-31(13-11-26)14-15-35-19-4-2-3-5-19/h6-7,16-17,19,22,33H,2-5,8-15H2,1H3,(H,30,32)/t22-/m1/s1 |
| InChIKey | CJDJOEWOUDGFIG-JOCHJYFZSA-N |
| XLogP | 5.95 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.10 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|