C27H39FN4O3S — CID 20796221
4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 20796221) has the molecular formula C27H39FN4O3S and a molecular weight of 518.70 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796221 |
| Molecular Formula | C27H39FN4O3S |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclopentylsulfanylethyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN)c([C@H](F)CCC3(C(=O)NO)CCN(CCSC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C27H39FN4O3S/c1-35-20-6-7-24-22(16-20)25(19(17-29)18-30-24)23(28)8-9-27(26(33)31-34)10-12-32(13-11-27)14-15-36-21-4-2-3-5-21/h6-7,16,18,21,23,34H,2-5,8-15,17,29H2,1H3,(H,31,33)/t23-/m1/s1 |
| InChIKey | AHDQAGDLIUHAPD-HSZRJFAPSA-N |
| XLogP | 4.76 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|