C28H42N4O4S — CID 20797781
1-(2-cyclopentylsulfanylethyl)-4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 20797781) has the molecular formula C28H42N4O4S and a molecular weight of 530.74 g/mol. Its IUPAC name is 1-(2-cyclopentylsulfanylethyl)-4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-(2-cyclopentylsulfanylethyl)-4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797781 |
| Molecular Formula | C28H42N4O4S |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1-(2-cyclopentylsulfanylethyl)-4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(N(C)C)c([C@H](O)CCC3(C(=O)NO)CCN(CCSC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C28H42N4O4S/c1-31(2)24-19-29-23-9-8-20(36-3)18-22(23)26(24)25(33)10-11-28(27(34)30-35)12-14-32(15-13-28)16-17-37-21-6-4-5-7-21/h8-9,18-19,21,25,33,35H,4-7,10-17H2,1-3H3,(H,30,34)/t25-/m1/s1 |
| InChIKey | GFYCVJZABCWEPY-RUZDIDTESA-N |
| XLogP | 4.39 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|