C29H35F4N5O3 — CID 20796707
4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 20796707) has the molecular formula C29H35F4N5O3 and a molecular weight of 577.62 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796707 |
| Molecular Formula | C29H35F4N5O3 |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(N(C)C)c([C@H](F)CCC3(C(=O)NO)CCN(CCNc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C29H35F4N5O3/c1-37(2)25-17-35-24-5-4-19(41-3)16-20(24)26(25)21(31)6-7-29(28(39)36-40)8-11-38(12-9-29)13-10-34-27-22(32)14-18(30)15-23(27)33/h4-5,14-17,21,34,40H,6-13H2,1-3H3,(H,36,39)/t21-/m1/s1 |
| InChIKey | YCLWJTVACQAVIV-OAQYLSRUSA-N |
| XLogP | 5.22 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|