C30H36F4N4O3 — CID 22469993
4-[3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxamide (PubChem CID 22469993) has the molecular formula C30H36F4N4O3 and a molecular weight of 576.64 g/mol. Its IUPAC name is 4-[3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469993 |
| Molecular Formula | C30H36F4N4O3 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 4-[3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(N(C)C)c(C(F)CCC3(C(=O)NO)CCN(CCCc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C30H36F4N4O3/c1-37(2)26-18-35-25-7-6-21(41-3)17-22(25)27(26)23(32)8-9-30(29(39)36-40)10-13-38(14-11-30)12-4-5-19-15-20(31)16-24(33)28(19)34/h6-7,15-18,23,40H,4-5,8-14H2,1-3H3,(H,36,39) |
| InChIKey | ONRCTAUNGOUBBQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|