C28H32ClF2N3O4 — CID 22469800
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[3-(2,3-difluorophenyl)propyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22469800) has the molecular formula C28H32ClF2N3O4 and a molecular weight of 548.03 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[3-(2,3-difluorophenyl)propyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[3-(2,3-difluorophenyl)propyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469800 |
| Molecular Formula | C28H32ClF2N3O4 |
| Molecular Weight | 548.03 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[3-(2,3-difluorophenyl)propyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(C(=O)NO)CCN(CCCc4cccc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C28H32ClF2N3O4/c1-38-19-7-8-23-20(16-19)25(21(29)17-32-23)24(35)9-10-28(27(36)33-37)11-14-34(15-12-28)13-3-5-18-4-2-6-22(30)26(18)31/h2,4,6-8,16-17,24,35,37H,3,5,9-15H2,1H3,(H,33,36) |
| InChIKey | XRIWFKYYVAPFPN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|