C29H34F3N3O4 — CID 20798172
N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide (PubChem CID 20798172) has the molecular formula C29H34F3N3O4 and a molecular weight of 545.60 g/mol. Its IUPAC name is N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20798172 |
| Molecular Formula | C29H34F3N3O4 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(C)c([C@H](O)CCC3(C(=O)NO)CCN(CCCc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H34F3N3O4/c1-18-17-33-24-6-5-20(39-2)16-21(24)26(18)25(36)7-8-29(28(37)34-38)9-12-35(13-10-29)11-3-4-19-14-22(30)27(32)23(31)15-19/h5-6,14-17,25,36,38H,3-4,7-13H2,1-2H3,(H,34,37)/t25-/m1/s1 |
| InChIKey | AGQBJFIDZJLTDW-RUZDIDTESA-N |
| XLogP | 5.00 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|