C29H35F3N4O3 — CID 22468757
4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide (PubChem CID 22468757) has the molecular formula C29H35F3N4O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is 4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468757 |
| Molecular Formula | C29H35F3N4O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN)c(CCCC3(C(=O)NO)CCN(CCCc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H35F3N4O3/c1-39-21-6-7-26-23(16-21)22(20(17-33)18-34-26)5-2-8-29(28(37)35-38)9-12-36(13-10-29)11-3-4-19-14-24(30)27(32)25(31)15-19/h6-7,14-16,18,38H,2-5,8-13,17,33H2,1H3,(H,35,37) |
| InChIKey | ILUFXIUYOVFVDH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|