C27H30F3N3O4 — CID 22468616
1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22468616) has the molecular formula C27H30F3N3O4 and a molecular weight of 517.55 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468616 |
| Molecular Formula | C27H30F3N3O4 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(F)c(CCCC3(C(=O)NO)CCN(CCOc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C27H30F3N3O4/c1-36-20-4-5-25-23(16-20)22(24(30)17-31-25)3-2-6-27(26(34)32-35)7-9-33(10-8-27)11-12-37-21-14-18(28)13-19(29)15-21/h4-5,13-17,35H,2-3,6-12H2,1H3,(H,32,34) |
| InChIKey | QOBBIIRBIYDTSR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|