C28H32F4N4O4 — CID 20797941
4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 20797941) has the molecular formula C28H32F4N4O4 and a molecular weight of 564.58 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797941 |
| Molecular Formula | C28H32F4N4O4 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CF)c([C@H](O)CCC3(C(=O)NO)CCN(CCNc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H32F4N4O4/c1-40-19-2-3-23-20(14-19)25(17(15-29)16-34-23)24(37)4-5-28(27(38)35-39)6-9-36(10-7-28)11-8-33-18-12-21(30)26(32)22(31)13-18/h2-3,12-14,16,24,33,37,39H,4-11,15H2,1H3,(H,35,38)/t24-/m1/s1 |
| InChIKey | QORIUOJYESGXKR-XMMPIXPASA-N |
| XLogP | 4.64 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|