C28H32F3N3O4S — CID 20798101
N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 20798101) has the molecular formula C28H32F3N3O4S and a molecular weight of 563.64 g/mol. Its IUPAC name is N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20798101 |
| Molecular Formula | C28H32F3N3O4S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-hydroxy-4-[(3R)-3-hydroxy-3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(C)c([C@H](O)CCC3(C(=O)NO)CCN(CCSc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C28H32F3N3O4S/c1-17-16-32-22-4-3-19(38-2)15-20(22)25(17)23(35)5-6-28(27(36)33-37)7-9-34(10-8-28)11-12-39-24-14-18(29)13-21(30)26(24)31/h3-4,13-16,23,35,37H,5-12H2,1-2H3,(H,33,36)/t23-/m1/s1 |
| InChIKey | QCRSYPDCBUQABM-HSZRJFAPSA-N |
| XLogP | 5.16 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|