C28H32F3N3O5S — CID 22470005
N-hydroxy-4-[3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 22470005) has the molecular formula C28H32F3N3O5S and a molecular weight of 579.64 g/mol. Its IUPAC name is N-hydroxy-4-[3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470005 |
| Molecular Formula | C28H32F3N3O5S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | N-hydroxy-4-[3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CO)c(C(O)CCC3(C(=O)NO)CCN(CCSc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C28H32F3N3O5S/c1-39-19-2-3-23-20(14-19)25(17(16-35)15-32-23)24(36)4-5-28(27(37)33-38)6-8-34(9-7-28)10-11-40-26-21(30)12-18(29)13-22(26)31/h2-3,12-15,24,35-36,38H,4-11,16H2,1H3,(H,33,37) |
| InChIKey | POMGTRBLPHPNPW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|