C29H34Cl2N2O3S — CID 22469262
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3-chlorophenyl)sulfanylpropyl]piperidin-4-yl]acetic acid (PubChem CID 22469262) has the molecular formula C29H34Cl2N2O3S and a molecular weight of 561.58 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3-chlorophenyl)sulfanylpropyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3-chlorophenyl)sulfanylpropyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22469262 |
| Molecular Formula | C29H34Cl2N2O3S |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(3-chlorophenyl)sulfanylpropyl]piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(CC(=O)O)CCN(CCCSc4cccc(Cl)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H34Cl2N2O3S/c1-36-22-8-9-27-25(18-22)24(26(31)20-32-27)7-3-10-29(19-28(34)35)11-14-33(15-12-29)13-4-16-37-23-6-2-5-21(30)17-23/h2,5-6,8-9,17-18,20H,3-4,7,10-16,19H2,1H3,(H,34,35) |
| InChIKey | LRCRBTFKMGWFEX-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|