C27H38ClFN2O2S — CID 22469112
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(3-cyclopentylsulfanylpropyl)piperidin-4-yl]methanol (PubChem CID 22469112) has the molecular formula C27H38ClFN2O2S and a molecular weight of 509.13 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(3-cyclopentylsulfanylpropyl)piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(3-cyclopentylsulfanylpropyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22469112 |
| Molecular Formula | C27H38ClFN2O2S |
| Molecular Weight | 509.13 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-(3-cyclopentylsulfanylpropyl)piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(CO)CCN(CCCSC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C27H38ClFN2O2S/c1-33-20-7-8-25-22(17-20)26(23(28)18-30-25)24(29)9-10-27(19-32)11-14-31(15-12-27)13-4-16-34-21-5-2-3-6-21/h7-8,17-18,21,24,32H,2-6,9-16,19H2,1H3 |
| InChIKey | YLDMFBDGTGMZSV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.13 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|