C28H33Cl2FN2O2S — CID 22470125
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]piperidin-4-yl]methanol (PubChem CID 22470125) has the molecular formula C28H33Cl2FN2O2S and a molecular weight of 551.56 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22470125 |
| Molecular Formula | C28H33Cl2FN2O2S |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(CO)CCN(CCCSc4ccc(Cl)cc4)CC3)c2c1 |
| InChI | InChI=1S/C28H33Cl2FN2O2S/c1-35-21-5-8-26-23(17-21)27(24(30)18-32-26)25(31)9-10-28(19-34)11-14-33(15-12-28)13-2-16-36-22-6-3-20(29)4-7-22/h3-8,17-18,25,34H,2,9-16,19H2,1H3 |
| InChIKey | YHIOVXAHJFJSNO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|