C32H39F3N4O5 — CID 22471048
1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22471048) has the molecular formula C32H39F3N4O5 and a molecular weight of 616.68 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22471048 |
| Molecular Formula | C32H39F3N4O5 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c(C(F)CCC3(C(=O)NO)CCN(CCOc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C32H39F3N4O5/c1-42-25-2-3-29-27(19-25)30(22(20-36-29)21-39-10-13-43-14-11-39)28(35)4-5-32(31(40)37-41)6-8-38(9-7-32)12-15-44-26-17-23(33)16-24(34)18-26/h2-3,16-20,28,41H,4-15,21H2,1H3,(H,37,40) |
| InChIKey | QPPFKFMCMCNHCO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|