C32H39F3N4O6 — CID 22469955
N-hydroxy-4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(2,3,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 22469955) has the molecular formula C32H39F3N4O6 and a molecular weight of 632.68 g/mol. Its IUPAC name is N-hydroxy-4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(2,3,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(2,3,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469955 |
| Molecular Formula | C32H39F3N4O6 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | N-hydroxy-4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(2,3,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c(C(O)CCC3(C(=O)NO)CCN(CCOc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C32H39F3N4O6/c1-43-23-2-3-26-24(18-23)29(21(19-36-26)20-39-10-13-44-14-11-39)27(40)4-5-32(31(41)37-42)6-8-38(9-7-32)12-15-45-28-17-22(33)16-25(34)30(28)35/h2-3,16-19,27,40,42H,4-15,20H2,1H3,(H,37,41) |
| InChIKey | RNGDLRMMEBGODJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|