C22H17N5OS — CID 143877197
3-[4-[(6-ethyl-1,3-benzothiazol-2-yl)amino]phenyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde (PubChem CID 143877197) has the molecular formula C22H17N5OS and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-[4-[(6-ethyl-1,3-benzothiazol-2-yl)amino]phenyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde.
| Compound Name | 3-[4-[(6-ethyl-1,3-benzothiazol-2-yl)amino]phenyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 143877197 |
| Molecular Formula | C22H17N5OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-[4-[(6-ethyl-1,3-benzothiazol-2-yl)amino]phenyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde |
| SMILES | CCc1ccc2nc(Nc3ccc(-c4nnc5c(C=O)cccn45)cc3)sc2c1 |
| InChI | InChI=1S/C22H17N5OS/c1-2-14-5-10-18-19(12-14)29-22(24-18)23-17-8-6-15(7-9-17)20-25-26-21-16(13-28)4-3-11-27(20)21/h3-13H,2H2,1H3,(H,23,24) |
| InChIKey | BTENVNYSYGNFJW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|