C12H19N3O5 — CID 143878296
1-[3-methoxy-2-(oxan-2-yloxy)propyl]-2-nitroimidazole (PubChem CID 143878296) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-[3-methoxy-2-(oxan-2-yloxy)propyl]-2-nitroimidazole.
| Compound Name | 1-[3-methoxy-2-(oxan-2-yloxy)propyl]-2-nitroimidazole |
|---|---|
| PubChem CID | 143878296 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[3-methoxy-2-(oxan-2-yloxy)propyl]-2-nitroimidazole |
| SMILES | COCC(Cn1ccnc1[N+](=O)[O-])OC1CCCCO1 |
| InChI | InChI=1S/C12H19N3O5/c1-18-9-10(20-11-4-2-3-7-19-11)8-14-6-5-13-12(14)15(16)17/h5-6,10-11H,2-4,7-9H2,1H3 |
| InChIKey | YZNWWRHCHAHNSP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|