C33H49N5O10 — CID 162352872
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[2-[[2-(2-nitroimidazol-1-yl)acetyl]-[3-(oxan-2-yloxy)propyl]amino]ethoxy]phenyl]propanoate (PubChem CID 162352872) has the molecular formula C33H49N5O10 and a molecular weight of 675.78 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[2-[[2-(2-nitroimidazol-1-yl)acetyl]-[3-(oxan-2-yloxy)propyl]amino]ethoxy]phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[2-[[2-(2-nitroimidazol-1-yl)acetyl]-[3-(oxan-2-yloxy)propyl]amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 162352872 |
| Molecular Formula | C33H49N5O10 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.35 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[2-[[2-(2-nitroimidazol-1-yl)acetyl]-[3-(oxan-2-yloxy)propyl]amino]ethoxy]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OCCN(CCCOC2CCCCO2)C(=O)Cn2ccnc2[N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H49N5O10/c1-32(2,3)47-29(40)26(35-31(41)48-33(4,5)6)22-24-11-13-25(14-12-24)44-21-18-36(16-9-20-46-28-10-7-8-19-45-28)27(39)23-37-17-15-34-30(37)38(42)43/h11-15,17,26,28H,7-10,16,18-23H2,1-6H3,(H,35,41)/t26-,28?/m0/s1 |
| InChIKey | XULBZAOXZDPCJT-QODXOHEASA-N |
| XLogP | 4.41 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|