C35H43N3O8 — CID 87232362
[4-[4-(oxan-2-yloxyamino)-4-oxobutyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-phenylmethoxy-2-pyridinyl)propanoate (PubChem CID 87232362) has the molecular formula C35H43N3O8 and a molecular weight of 633.74 g/mol. Its IUPAC name is [4-[4-(oxan-2-yloxyamino)-4-oxobutyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-phenylmethoxy-2-pyridinyl)propanoate.
| Compound Name | [4-[4-(oxan-2-yloxyamino)-4-oxobutyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-phenylmethoxy-2-pyridinyl)propanoate |
|---|---|
| PubChem CID | 87232362 |
| Molecular Formula | C35H43N3O8 |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | [4-[4-(oxan-2-yloxyamino)-4-oxobutyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-phenylmethoxy-2-pyridinyl)propanoate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(OCc2ccccc2)cn1)C(=O)Oc1ccc(CCCC(=O)NOC2CCCCO2)cc1 |
| InChI | InChI=1S/C35H43N3O8/c1-35(2,3)45-34(41)37-30(22-27-17-20-29(23-36-27)43-24-26-10-5-4-6-11-26)33(40)44-28-18-15-25(16-19-28)12-9-13-31(39)38-46-32-14-7-8-21-42-32/h4-6,10-11,15-20,23,30,32H,7-9,12-14,21-22,24H2,1-3H3,(H,37,41)(H,38,39) |
| InChIKey | XBMWCQXNBARXEI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|