C25H26Cl2N3O5S+ — CID 143878829
[N-[7-[(3,5-dichlorophenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]naphthalene-2-carboximidoyl]-C-methylcarbonimidoyl]oxidanium (PubChem CID 143878829) has the molecular formula C25H26Cl2N3O5S+ and a molecular weight of 551.47 g/mol. Its IUPAC name is [N-[7-[(3,5-dichlorophenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]naphthalene-2-carboximidoyl]-C-methylcarbonimidoyl]oxidanium.
| Compound Name | [N-[7-[(3,5-dichlorophenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]naphthalene-2-carboximidoyl]-C-methylcarbonimidoyl]oxidanium |
|---|---|
| PubChem CID | 143878829 |
| Molecular Formula | C25H26Cl2N3O5S+ |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | [N-[7-[(3,5-dichlorophenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]naphthalene-2-carboximidoyl]-C-methylcarbonimidoyl]oxidanium |
| SMILES | [H]/N=C(\N=C(/C)[OH2+])c1ccc2ccc(N(CC(=O)OC(C)(C)C)S(=O)(=O)c3cc(Cl)cc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C25H25Cl2N3O5S/c1-15(31)29-24(28)17-6-5-16-7-8-21(10-18(16)9-17)30(14-23(32)35-25(2,3)4)36(33,34)22-12-19(26)11-20(27)13-22/h5-13H,14H2,1-4H3,(H2,28,29,31)/p+1 |
| InChIKey | BUEJZIAJIZAALY-UHFFFAOYSA-O |
| XLogP | 5.15 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|