C15H29NO2 — CID 143879791
N-[(2S)-2-ethenylcyclopropyl]formamide;2-methoxy-2-methylpropane;2-methylprop-1-ene (PubChem CID 143879791) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is N-[(2S)-2-ethenylcyclopropyl]formamide;2-methoxy-2-methylpropane;2-methylprop-1-ene.
| Compound Name | N-[(2S)-2-ethenylcyclopropyl]formamide;2-methoxy-2-methylpropane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143879791 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-[(2S)-2-ethenylcyclopropyl]formamide;2-methoxy-2-methylpropane;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C[C@@H]1CC1NC=O.COC(C)(C)C |
| InChI | InChI=1S/C6H9NO.C5H12O.C4H8/c1-2-5-3-6(5)7-4-8;1-5(2,3)6-4;1-4(2)3/h2,4-6H,1,3H2,(H,7,8);1-4H3;1H2,2-3H3/t5-,6?;;/m1../s1 |
| InChIKey | IALXIXNITZKMDN-BLJHELNISA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|