C15H12N2O2 — CID 143880138
1,2-benzoxazole;6-methyl-1,3-benzoxazole (PubChem CID 143880138) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1,2-benzoxazole;6-methyl-1,3-benzoxazole.
| Compound Name | 1,2-benzoxazole;6-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 143880138 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1,2-benzoxazole;6-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2ncoc2c1.c1ccc2oncc2c1 |
| InChI | InChI=1S/C8H7NO.C7H5NO/c1-6-2-3-7-8(4-6)10-5-9-7;1-2-4-7-6(3-1)5-8-9-7/h2-5H,1H3;1-5H |
| InChIKey | RHUPPRHXJKLKCI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |