C31H47NO7 — CID 143880232
(8E)-17-(aminomethyl)-11-methoxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-ene-12,19-dione (PubChem CID 143880232) has the molecular formula C31H47NO7 and a molecular weight of 545.72 g/mol. Its IUPAC name is (8E)-17-(aminomethyl)-11-methoxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-ene-12,19-dione.
| Compound Name | (8E)-17-(aminomethyl)-11-methoxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-ene-12,19-dione |
|---|---|
| PubChem CID | 143880232 |
| Molecular Formula | C31H47NO7 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | (8E)-17-(aminomethyl)-11-methoxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-ene-12,19-dione |
| SMILES | C=C1CC2/C=C\C(C)(C)C3(OC)OC(CCC3=O)CC(CN)OC(=O)CCCC3CC(=C)CC(CC(C1)O2)O3 |
| InChI | InChI=1S/C31H47NO7/c1-20-13-22-7-6-8-29(34)38-27(19-32)17-24-9-10-28(33)31(35-5,39-24)30(3,4)12-11-23-14-21(2)16-26(37-23)18-25(15-20)36-22/h11-12,22-27H,1-2,6-10,13-19,32H2,3-5H3/b12-11- |
| InChIKey | DMOOERJPNSSEIU-QXMHVHEDSA-N |
| XLogP | 4.70 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|