C39H64O8 — CID 143880224
(8E)-17-ethyl-11-hydroxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-en-19-one;octanoic acid (PubChem CID 143880224) has the molecular formula C39H64O8 and a molecular weight of 660.93 g/mol. Its IUPAC name is (8E)-17-ethyl-11-hydroxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-en-19-one;octanoic acid.
| Compound Name | (8E)-17-ethyl-11-hydroxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-en-19-one;octanoic acid |
|---|---|
| PubChem CID | 143880224 |
| Molecular Formula | C39H64O8 |
| Molecular Weight | 660.93 g/mol |
| Exact Mass | 660.46 |
| IUPAC Name | (8E)-17-ethyl-11-hydroxy-10,10-dimethyl-5,25-dimethylidene-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-en-19-one;octanoic acid |
| SMILES | C=C1CC2/C=C\C(C)(C)C3(O)CCCC(CC(CC)OC(=O)CCCC4CC(=C)CC(CC(C1)O2)O4)O3.CCCCCCCC(=O)O |
| InChI | InChI=1S/C31H48O6.C8H16O2/c1-6-23-19-26-10-8-13-31(33,37-26)30(4,5)14-12-25-16-22(3)18-28(35-25)20-27-17-21(2)15-24(34-27)9-7-11-29(32)36-23;1-2-3-4-5-6-7-8(9)10/h12,14,23-28,33H,2-3,6-11,13,15-20H2,1,4-5H3;2-7H2,1H3,(H,9,10)/b14-12-; |
| InChIKey | BIVVPOBINXGTHQ-CTMPBGLUSA-N |
| XLogP | 8.75 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.93 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|